C14H16BrN5O3 — CID 135805840
butyl 7-(5-bromofuran-2-yl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805840) has the molecular formula C14H16BrN5O3 and a molecular weight of 382.22 g/mol. Its IUPAC name is butyl 7-(5-bromofuran-2-yl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-(5-bromofuran-2-yl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805840 |
| Molecular Formula | C14H16BrN5O3 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | butyl 7-(5-bromofuran-2-yl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2nnnn2C1c1ccc(Br)o1 |
| InChI | InChI=1S/C14H16BrN5O3/c1-3-4-7-22-13(21)11-8(2)16-14-17-18-19-20(14)12(11)9-5-6-10(15)23-9/h5-6,12H,3-4,7H2,1-2H3,(H,16,17,19) |
| InChIKey | JSCFAGUIIUECPA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|