C26H34N2O5S — CID 135810094
4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-N-[(3,4,5-triethoxyphenyl)methyl]-1,2-thiazol-3-imine (PubChem CID 135810094) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-N-[(3,4,5-triethoxyphenyl)methyl]-1,2-thiazol-3-imine.
| Compound Name | 4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-N-[(3,4,5-triethoxyphenyl)methyl]-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135810094 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 4-methyl-1,1-dioxo-5-(4-propan-2-ylphenyl)-N-[(3,4,5-triethoxyphenyl)methyl]-1,2-thiazol-3-imine |
| SMILES | CCOc1cc(C/N=C2\NS(=O)(=O)C(c3ccc(C(C)C)cc3)=C2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H34N2O5S/c1-7-31-22-14-19(15-23(32-8-2)24(22)33-9-3)16-27-26-18(6)25(34(29,30)28-26)21-12-10-20(11-13-21)17(4)5/h10-15,17H,7-9,16H2,1-6H3,(H,27,28) |
| InChIKey | ZOPZNCLKKSBESD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|