C23H32N2O4 — CID 108869694
1-[1-(4-ethylphenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea (PubChem CID 108869694) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[1-(4-ethylphenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea.
| Compound Name | 1-[1-(4-ethylphenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869694 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[1-(4-ethylphenyl)ethyl]-3-(3,4,5-triethoxyphenyl)urea |
| SMILES | CCOc1cc(NC(=O)NC(C)c2ccc(CC)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H32N2O4/c1-6-17-10-12-18(13-11-17)16(5)24-23(26)25-19-14-20(27-7-2)22(29-9-4)21(15-19)28-8-3/h10-16H,6-9H2,1-5H3,(H2,24,25,26) |
| InChIKey | FGFOLQGAOMILRM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |