C19H19Cl2N3O5 — CID 135810672
4-(2,4-dichlorophenoxy)-N-[2-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide (PubChem CID 135810672) has the molecular formula C19H19Cl2N3O5 and a molecular weight of 440.28 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[2-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[2-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 135810672 |
| Molecular Formula | C19H19Cl2N3O5 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[2-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NCC(=O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C19H19Cl2N3O5/c20-13-4-6-17(15(21)8-13)29-7-1-2-18(27)22-11-19(28)24-23-10-12-3-5-14(25)9-16(12)26/h3-6,8-10,25-26H,1-2,7,11H2,(H,22,27)(H,24,28)/b23-10+ |
| InChIKey | NSMCSNXCDTYSSC-AUEPDCJTSA-N |
| XLogP | 2.83 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|