About 2-imino-7H-purin-1-amine
2-imino-7H-purin-1-amine (PubChem CID 135813677) has the molecular formula C5H6N6
and a molecular weight of 150.15 g/mol. Its IUPAC name is 2-imino-7H-purin-1-amine.
Molecular Properties
| Compound Name | 2-imino-7H-purin-1-amine |
| PubChem CID | 135813677 |
| Molecular Formula | C5H6N6 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-imino-7H-purin-1-amine |
| SMILES | [H]/N=c1\nc2nc[nH]c2cn1N |
| InChI | InChI=1S/C5H6N6/c6-5-10-4-3(1-11(5)7)8-2-9-4/h1-2H,7H2,(H2,6,8,9,10) |
| InChIKey | OMXQCGKNMSNBFH-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imino-7H-purin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-7H-purin-1-amine?
The IUPAC name of 2-imino-7H-purin-1-amine (CID 135813677) is 2-imino-7H-purin-1-amine.
What is the SMILES notation for 2-imino-7H-purin-1-amine?
The canonical SMILES for 2-imino-7H-purin-1-amine is [H]/N=c1\nc2nc[nH]c2cn1N.
What is the InChIKey of 2-imino-7H-purin-1-amine?
The InChIKey is OMXQCGKNMSNBFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N6/c6-5-10-4-3(1-11(5)7)8-2-9-4/h1-2H,7H2,(H2,6,8,9,10).
What are the key properties of 2-imino-7H-purin-1-amine?
2-imino-7H-purin-1-amine has a molecular weight of 150.15 g/mol, XLogP of -1.05, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-7H-purin-1-amine is sourced from PubChem (CID 135813677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).