C16H22FN3OS — CID 135816185
1-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 135816185) has the molecular formula C16H22FN3OS and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 135816185 |
| Molecular Formula | C16H22FN3OS |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[(E)-1-(5-fluoro-2-hydroxyphenyl)ethylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C/C(=N\NC(=S)N[C@@H]1CCCC[C@@H]1C)c1cc(F)ccc1O |
| InChI | InChI=1S/C16H22FN3OS/c1-10-5-3-4-6-14(10)18-16(22)20-19-11(2)13-9-12(17)7-8-15(13)21/h7-10,14,21H,3-6H2,1-2H3,(H2,18,20,22)/b19-11+/t10-,14+/m0/s1 |
| InChIKey | YGMHQDNPPQBREJ-YHTGWXLMSA-N |
| XLogP | 3.30 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|