C15H20F2N4S2 — CID 8654321
1-(2,4-difluorophenyl)-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea (PubChem CID 8654321) has the molecular formula C15H20F2N4S2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8654321 |
| Molecular Formula | C15H20F2N4S2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[(1R,2R)-2-methylcyclohexyl]carbamothioylamino]thiourea |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)NNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2N4S2/c1-9-4-2-3-5-12(9)18-14(22)20-21-15(23)19-13-7-6-10(16)8-11(13)17/h6-9,12H,2-5H2,1H3,(H2,18,20,22)(H2,19,21,23)/t9-,12-/m1/s1 |
| InChIKey | MVXNCUDIVUXZPE-BXKDBHETSA-N |
| XLogP | 3.21 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|