C13H13Cl2N3O2 — CID 135817128
4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,2-dihydropyrazol-3-one (PubChem CID 135817128) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135817128 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]cc1CCC/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-10-4-9(12(19)11(15)5-10)6-16-3-1-2-8-7-17-18-13(8)20/h4-7,19H,1-3H2,(H2,17,18,20)/b16-6+ |
| InChIKey | XLQKWPZZXJJLAX-OMCISZLKSA-N |
| XLogP | 2.77 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|