C12H12Cl2N2O2 — CID 135560599
N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclobutanecarboxamide (PubChem CID 135560599) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclobutanecarboxamide.
| Compound Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 135560599 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]cyclobutanecarboxamide |
| SMILES | O=C(N/N=C/c1cc(Cl)cc(Cl)c1O)C1CCC1 |
| InChI | InChI=1S/C12H12Cl2N2O2/c13-9-4-8(11(17)10(14)5-9)6-15-16-12(18)7-2-1-3-7/h4-7,17H,1-3H2,(H,16,18)/b15-6+ |
| InChIKey | IZNAAJKIIFRHLE-GIDUJCDVSA-N |
| XLogP | 2.95 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|