C23H26N8O2 — CID 135819971
2-(5-nitro-1H-indazol-3-yl)-5-(4-piperidin-1-ylpiperidin-1-yl)-1H-imidazo[4,5-b]pyridine (PubChem CID 135819971) has the molecular formula C23H26N8O2 and a molecular weight of 446.52 g/mol. Its IUPAC name is 2-(5-nitro-1H-indazol-3-yl)-5-(4-piperidin-1-ylpiperidin-1-yl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-(5-nitro-1H-indazol-3-yl)-5-(4-piperidin-1-ylpiperidin-1-yl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 135819971 |
| Molecular Formula | C23H26N8O2 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 2-(5-nitro-1H-indazol-3-yl)-5-(4-piperidin-1-ylpiperidin-1-yl)-1H-imidazo[4,5-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc2[nH]nc(-c3nc4nc(N5CCC(N6CCCCC6)CC5)ccc4[nH]3)c2c1 |
| InChI | InChI=1S/C23H26N8O2/c32-31(33)16-4-5-18-17(14-16)21(28-27-18)23-24-19-6-7-20(25-22(19)26-23)30-12-8-15(9-13-30)29-10-2-1-3-11-29/h4-7,14-15H,1-3,8-13H2,(H,27,28)(H,24,25,26) |
| InChIKey | HQNJEANOZGHYKQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|