C8H15N6O2+ — CID 135821745
(NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(4-methylpiperazin-4-ium-1-yl)methylidene]hydroxylamine (PubChem CID 135821745) has the molecular formula C8H15N6O2+ and a molecular weight of 227.25 g/mol. Its IUPAC name is (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(4-methylpiperazin-4-ium-1-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(4-methylpiperazin-4-ium-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135821745 |
| Molecular Formula | C8H15N6O2+ |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (NZ)-N-[(4-amino-1,2,5-oxadiazol-3-yl)-(4-methylpiperazin-4-ium-1-yl)methylidene]hydroxylamine |
| SMILES | C[NH+]1CCN(/C(=N\O)c2nonc2N)CC1 |
| InChI | InChI=1S/C8H14N6O2/c1-13-2-4-14(5-3-13)8(10-15)6-7(9)12-16-11-6/h15H,2-5H2,1H3,(H2,9,12)/p+1/b10-8- |
| InChIKey | IHJJWBVRTIYDPA-NTMALXAHSA-O |
| XLogP | -2.38 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|