C19H12N3O6- — CID 135831246
4-[(4-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate (PubChem CID 135831246) has the molecular formula C19H12N3O6- and a molecular weight of 378.32 g/mol. Its IUPAC name is 4-[(4-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate.
| Compound Name | 4-[(4-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate |
|---|---|
| PubChem CID | 135831246 |
| Molecular Formula | C19H12N3O6- |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 4-[(4-carboxyphenyl)iminomethyl]-2-[(E)-2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-olate |
| SMILES | O=C(O)c1ccc(/N=C/c2nc(/C=C/c3cccc([N+](=O)[O-])c3)oc2[O-])cc1 |
| InChI | InChI=1S/C19H13N3O6/c23-18(24)13-5-7-14(8-6-13)20-11-16-19(25)28-17(21-16)9-4-12-2-1-3-15(10-12)22(26)27/h1-11,25H,(H,23,24)/p-1/b9-4+,20-11+ |
| InChIKey | GUNQQTLDVKXGQV-ZMAJVBOJSA-M |
| XLogP | 3.28 |
| TPSA | 141.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|