C19H14N4O6 — CID 3875329
4-[(4-methyl-2-nitrophenyl)iminomethyl]-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-ol (PubChem CID 3875329) has the molecular formula C19H14N4O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-[(4-methyl-2-nitrophenyl)iminomethyl]-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-ol.
| Compound Name | 4-[(4-methyl-2-nitrophenyl)iminomethyl]-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 3875329 |
| Molecular Formula | C19H14N4O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-[(4-methyl-2-nitrophenyl)iminomethyl]-2-[2-(3-nitrophenyl)ethenyl]-1,3-oxazol-5-ol |
| SMILES | Cc1ccc(/N=C/c2nc(C=Cc3cccc([N+](=O)[O-])c3)oc2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H14N4O6/c1-12-5-7-15(17(9-12)23(27)28)20-11-16-19(24)29-18(21-16)8-6-13-3-2-4-14(10-13)22(25)26/h2-11,24H,1H3/b8-6?,20-11+ |
| InChIKey | FJHVZNVXBQNVJC-BIVJYTFUSA-N |
| XLogP | 4.43 |
| TPSA | 144.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|