C25H26N6O4 — CID 135839454
(2E)-N'-[5-(4-benzylpiperazin-1-yl)-2-nitrophenyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide (PubChem CID 135839454) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2E)-N'-[5-(4-benzylpiperazin-1-yl)-2-nitrophenyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide.
| Compound Name | (2E)-N'-[5-(4-benzylpiperazin-1-yl)-2-nitrophenyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
|---|---|
| PubChem CID | 135839454 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (2E)-N'-[5-(4-benzylpiperazin-1-yl)-2-nitrophenyl]-N-hydroxy-2-hydroxyimino-2-phenylethanimidamide |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(Cc3ccccc3)CC2)cc1/N=C(NO)/C(=N/O)c1ccccc1 |
| InChI | InChI=1S/C25H26N6O4/c32-27-24(20-9-5-2-6-10-20)25(28-33)26-22-17-21(11-12-23(22)31(34)35)30-15-13-29(14-16-30)18-19-7-3-1-4-8-19/h1-12,17,32-33H,13-16,18H2,(H,26,28)/b27-24+ |
| InChIKey | KLSMGTMRQWBUNW-SOYKGTTHSA-N |
| XLogP | 3.80 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|