C17H22N6O2 — CID 135841332
5-(3,4-dimethylanilino)-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135841332) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-(3,4-dimethylanilino)-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-(3,4-dimethylanilino)-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135841332 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-(3,4-dimethylanilino)-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | COCCCCn1nnc2nc(Nc3ccc(C)c(C)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H22N6O2/c1-11-6-7-13(10-12(11)2)18-17-19-15-14(16(24)20-17)23(22-21-15)8-4-5-9-25-3/h6-7,10H,4-5,8-9H2,1-3H3,(H2,18,19,20,24) |
| InChIKey | ZTQBYTQYVOUJOC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|