C19H26N6O2 — CID 135486059
5-[(3-ethyl-4-methylphenyl)methylamino]-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135486059) has the molecular formula C19H26N6O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 5-[(3-ethyl-4-methylphenyl)methylamino]-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-[(3-ethyl-4-methylphenyl)methylamino]-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135486059 |
| Molecular Formula | C19H26N6O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 5-[(3-ethyl-4-methylphenyl)methylamino]-1-(4-methoxybutyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCc1cc(CNc2nc3nnn(CCCCOC)c3c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C19H26N6O2/c1-4-15-11-14(8-7-13(15)2)12-20-19-21-17-16(18(26)22-19)25(24-23-17)9-5-6-10-27-3/h7-8,11H,4-6,9-10,12H2,1-3H3,(H2,20,21,22,26) |
| InChIKey | QIBQQSQCMHTXLN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|