C19H25N5O2 — CID 135522314
2-[(3,4-dimethylphenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one (PubChem CID 135522314) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one.
| Compound Name | 2-[(3,4-dimethylphenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135522314 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one |
| SMILES | COCCCCn1cnc2nc(NCc3ccc(C)c(C)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C19H25N5O2/c1-13-6-7-15(10-14(13)2)11-20-19-22-17-16(18(25)23-19)24(12-21-17)8-4-5-9-26-3/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H2,20,22,23,25) |
| InChIKey | IHTUUBXJXSMVBM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|