C21H29N5OS — CID 135486073
2-[(3-ethyl-4-methylphenyl)methylamino]-7-(5-methylsulfanylpentyl)-1H-purin-6-one (PubChem CID 135486073) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-[(3-ethyl-4-methylphenyl)methylamino]-7-(5-methylsulfanylpentyl)-1H-purin-6-one.
| Compound Name | 2-[(3-ethyl-4-methylphenyl)methylamino]-7-(5-methylsulfanylpentyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135486073 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[(3-ethyl-4-methylphenyl)methylamino]-7-(5-methylsulfanylpentyl)-1H-purin-6-one |
| SMILES | CCc1cc(CNc2nc3ncn(CCCCCSC)c3c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C21H29N5OS/c1-4-17-12-16(9-8-15(17)2)13-22-21-24-19-18(20(27)25-21)26(14-23-19)10-6-5-7-11-28-3/h8-9,12,14H,4-7,10-11,13H2,1-3H3,(H2,22,24,25,27) |
| InChIKey | IVISWYWOTUURNZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|