C23H33N5O2 — CID 10237857
6-[(3-ethyl-4-methylphenyl)methylamino]-3-(5-propoxypentyl)-5H-triazolo[4,5-c]pyridin-4-one (PubChem CID 10237857) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-[(3-ethyl-4-methylphenyl)methylamino]-3-(5-propoxypentyl)-5H-triazolo[4,5-c]pyridin-4-one.
| Compound Name | 6-[(3-ethyl-4-methylphenyl)methylamino]-3-(5-propoxypentyl)-5H-triazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 10237857 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 6-[(3-ethyl-4-methylphenyl)methylamino]-3-(5-propoxypentyl)-5H-triazolo[4,5-c]pyridin-4-one |
| SMILES | CCCOCCCCCn1nnc2cc(NCc3ccc(C)c(CC)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C23H33N5O2/c1-4-12-30-13-8-6-7-11-28-22-20(26-27-28)15-21(25-23(22)29)24-16-18-10-9-17(3)19(5-2)14-18/h9-10,14-15H,4-8,11-13,16H2,1-3H3,(H2,24,25,29) |
| InChIKey | BACCWRROXWALPL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|