C21H27N5O3 — CID 135841320
5-[2-(3-ethyl-4-methylanilino)-6-oxo-1H-purin-7-yl]pentyl acetate (PubChem CID 135841320) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is 5-[2-(3-ethyl-4-methylanilino)-6-oxo-1H-purin-7-yl]pentyl acetate.
| Compound Name | 5-[2-(3-ethyl-4-methylanilino)-6-oxo-1H-purin-7-yl]pentyl acetate |
|---|---|
| PubChem CID | 135841320 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 5-[2-(3-ethyl-4-methylanilino)-6-oxo-1H-purin-7-yl]pentyl acetate |
| SMILES | CCc1cc(Nc2nc3ncn(CCCCCOC(C)=O)c3c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C21H27N5O3/c1-4-16-12-17(9-8-14(16)2)23-21-24-19-18(20(28)25-21)26(13-22-19)10-6-5-7-11-29-15(3)27/h8-9,12-13H,4-7,10-11H2,1-3H3,(H2,23,24,25,28) |
| InChIKey | WMBBPPVFFWFNNX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|