C18H19N3O5S — CID 135848871
(5S)-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 135848871) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is (5S)-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135848871 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (5S)-N-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc3c(s2)CC[C@H](C)C3)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C18H19N3O5S/c1-10-3-4-15-12(5-10)8-16(27-15)18(23)20-19-9-11-6-13(21(24)25)17(22)14(7-11)26-2/h6-10,22H,3-5H2,1-2H3,(H,20,23)/b19-9-/t10-/m0/s1 |
| InChIKey | KBIBPUUQTGGCMU-OVNPTBDBSA-N |
| XLogP | 3.26 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|