C19H18N2O4S — CID 135854865
2-[[2,4-dimethyl-5-(trioxidanylsulfanyl)phenyl]diazenyl]-4-methylnaphthalen-1-ol (PubChem CID 135854865) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[[2,4-dimethyl-5-(trioxidanylsulfanyl)phenyl]diazenyl]-4-methylnaphthalen-1-ol.
| Compound Name | 2-[[2,4-dimethyl-5-(trioxidanylsulfanyl)phenyl]diazenyl]-4-methylnaphthalen-1-ol |
|---|---|
| PubChem CID | 135854865 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-[[2,4-dimethyl-5-(trioxidanylsulfanyl)phenyl]diazenyl]-4-methylnaphthalen-1-ol |
| SMILES | Cc1cc(C)c(SOOO)cc1/N=N/c1cc(C)c2ccccc2c1O |
| InChI | InChI=1S/C19H18N2O4S/c1-11-9-17(19(22)15-7-5-4-6-14(11)15)21-20-16-10-18(26-25-24-23)13(3)8-12(16)2/h4-10,22-23H,1-3H3/b21-20+ |
| InChIKey | SLXLABQBOJGZMH-QZQOTICOSA-N |
| XLogP | 6.31 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|