C20H17BrN6O2 — CID 135857143
4-[(Z)-[[3-(4-bromophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]-2-ethoxyphenol (PubChem CID 135857143) has the molecular formula C20H17BrN6O2 and a molecular weight of 453.30 g/mol. Its IUPAC name is 4-[(Z)-[[3-(4-bromophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]-2-ethoxyphenol.
| Compound Name | 4-[(Z)-[[3-(4-bromophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]-2-ethoxyphenol |
|---|---|
| PubChem CID | 135857143 |
| Molecular Formula | C20H17BrN6O2 |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 4-[(Z)-[[3-(4-bromophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]hydrazinylidene]methyl]-2-ethoxyphenol |
| SMILES | CCOc1cc(/C=N\Nc2ccc3nnc(-c4ccc(Br)cc4)n3n2)ccc1O |
| InChI | InChI=1S/C20H17BrN6O2/c1-2-29-17-11-13(3-8-16(17)28)12-22-23-18-9-10-19-24-25-20(27(19)26-18)14-4-6-15(21)7-5-14/h3-12,28H,2H2,1H3,(H,23,26)/b22-12- |
| InChIKey | LLFKVBUEAVGECH-UUYOSTAYSA-N |
| XLogP | 4.10 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|