C13H11BrN6O — CID 5294949
4-bromo-2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)hydrazinylidene]methyl]phenol (PubChem CID 5294949) has the molecular formula C13H11BrN6O and a molecular weight of 347.18 g/mol. Its IUPAC name is 4-bromo-2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-bromo-2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 5294949 |
| Molecular Formula | C13H11BrN6O |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-bromo-2-[[(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1nnc2ccc(NN=Cc3cc(Br)ccc3O)nn12 |
| InChI | InChI=1S/C13H11BrN6O/c1-8-16-18-13-5-4-12(19-20(8)13)17-15-7-9-6-10(14)2-3-11(9)21/h2-7,21H,1H3,(H,17,19) |
| InChIKey | BEZSWBSRCJGLGA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|