C10H6N4O3 — CID 135859975
2-(4-nitro-1H-indol-2-yl)-1,3,4-oxadiazole (PubChem CID 135859975) has the molecular formula C10H6N4O3 and a molecular weight of 230.18 g/mol. Its IUPAC name is 2-(4-nitro-1H-indol-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-nitro-1H-indol-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 135859975 |
| Molecular Formula | C10H6N4O3 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(4-nitro-1H-indol-2-yl)-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cccc2[nH]c(-c3nnco3)cc12 |
| InChI | InChI=1S/C10H6N4O3/c15-14(16)9-3-1-2-7-6(9)4-8(12-7)10-13-11-5-17-10/h1-5,12H |
| InChIKey | MEWRNNPCVPPKOB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|