About 2-chloro-4-nitro-1H-indole;quinoline
2-chloro-4-nitro-1H-indole;quinoline (PubChem CID 174954659) has the molecular formula C17H12ClN3O2
and a molecular weight of 325.76 g/mol. Its IUPAC name is 2-chloro-4-nitro-1H-indole;quinoline.
Molecular Properties
| Compound Name | 2-chloro-4-nitro-1H-indole;quinoline |
| PubChem CID | 174954659 |
| Molecular Formula | C17H12ClN3O2 |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-chloro-4-nitro-1H-indole;quinoline |
| SMILES | O=[N+]([O-])c1cccc2[nH]c(Cl)cc12.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C8H5ClN2O2/c1-2-6-9-8(4-1)5-3-7-10-9;9-8-4-5-6(10-8)2-1-3-7(5)11(12)13/h1-7H;1-4,10H |
| InChIKey | SIBSYXCXUDDZDZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-nitro-1H-indole;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-nitro-1H-indole;quinoline?
The IUPAC name of 2-chloro-4-nitro-1H-indole;quinoline (CID 174954659) is 2-chloro-4-nitro-1H-indole;quinoline.
What is the SMILES notation for 2-chloro-4-nitro-1H-indole;quinoline?
The canonical SMILES for 2-chloro-4-nitro-1H-indole;quinoline is O=[N+]([O-])c1cccc2[nH]c(Cl)cc12.c1ccc2ncccc2c1.
What is the InChIKey of 2-chloro-4-nitro-1H-indole;quinoline?
The InChIKey is SIBSYXCXUDDZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C8H5ClN2O2/c1-2-6-9-8(4-1)5-3-7-10-9;9-8-4-5-6(10-8)2-1-3-7(5)11(12)13/h1-7H;1-4,10H.
What are the key properties of 2-chloro-4-nitro-1H-indole;quinoline?
2-chloro-4-nitro-1H-indole;quinoline has a molecular weight of 325.76 g/mol, XLogP of 4.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-nitro-1H-indole;quinoline is sourced from PubChem (CID 174954659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).