About 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline
2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline (PubChem CID 174899050) has the molecular formula C16H12ClN3
and a molecular weight of 281.75 g/mol. Its IUPAC name is 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline.
Molecular Properties
| Compound Name | 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline |
| PubChem CID | 174899050 |
| Molecular Formula | C16H12ClN3 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline |
| SMILES | Clc1cc2cccnc2[nH]1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C7H5ClN2/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-4-5-2-1-3-9-7(5)10-6/h1-7H;1-4H,(H,9,10) |
| InChIKey | VGXQSPSMEHSERM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline?
The IUPAC name of 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline (CID 174899050) is 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline.
What is the SMILES notation for 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline?
The canonical SMILES for 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline is Clc1cc2cccnc2[nH]1.c1ccc2ncccc2c1.
What is the InChIKey of 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline?
The InChIKey is VGXQSPSMEHSERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C7H5ClN2/c1-2-6-9-8(4-1)5-3-7-10-9;8-6-4-5-2-1-3-9-7(5)10-6/h1-7H;1-4H,(H,9,10).
What are the key properties of 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline?
2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline has a molecular weight of 281.75 g/mol, XLogP of 4.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-pyrrolo[2,3-b]pyridine;quinoline is sourced from PubChem (CID 174899050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).