C13H10N4O2S — CID 135860483
N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 135860483) has the molecular formula C13H10N4O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 135860483 |
| Molecular Formula | C13H10N4O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[(4-oxo-3H-quinazolin-2-yl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1nc2ccccc2c(=O)[nH]1)c1cscn1 |
| InChI | InChI=1S/C13H10N4O2S/c18-12-8-3-1-2-4-9(8)16-11(17-12)5-14-13(19)10-6-20-7-15-10/h1-4,6-7H,5H2,(H,14,19)(H,16,17,18) |
| InChIKey | QPZYGSPBSBAPEK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |