C22H20N2O3S — CID 135862953
3,5-dimethoxy-2-[2-(pyridin-2-ylmethyl)-2H-1,4-benzothiazin-3-yl]phenol (PubChem CID 135862953) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[2-(pyridin-2-ylmethyl)-2H-1,4-benzothiazin-3-yl]phenol.
| Compound Name | 3,5-dimethoxy-2-[2-(pyridin-2-ylmethyl)-2H-1,4-benzothiazin-3-yl]phenol |
|---|---|
| PubChem CID | 135862953 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 3,5-dimethoxy-2-[2-(pyridin-2-ylmethyl)-2H-1,4-benzothiazin-3-yl]phenol |
| SMILES | COc1cc(O)c(C2=Nc3ccccc3SC2Cc2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C22H20N2O3S/c1-26-15-12-17(25)21(18(13-15)27-2)22-20(11-14-7-5-6-10-23-14)28-19-9-4-3-8-16(19)24-22/h3-10,12-13,20,25H,11H2,1-2H3 |
| InChIKey | ZCXITFYEOJCTEQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |