C25H28N8S — CID 135867820
4-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 135867820) has the molecular formula C25H28N8S and a molecular weight of 472.62 g/mol. Its IUPAC name is 4-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 4-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135867820 |
| Molecular Formula | C25H28N8S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-[(E)-[5-(4-methylphenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2[nH]ncc2/C=N/n2c(-c3ccccc3)nn(CN3CCN(C)CC3)c2=S)cc1 |
| InChI | InChI=1S/C25H28N8S/c1-19-8-10-20(11-9-19)23-22(16-26-28-23)17-27-33-24(21-6-4-3-5-7-21)29-32(25(33)34)18-31-14-12-30(2)13-15-31/h3-11,16-17H,12-15,18H2,1-2H3,(H,26,28)/b27-17+ |
| InChIKey | SLJKICBODNZQHL-WPWMEQJKSA-N |
| XLogP | 3.87 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|