C21H27ClN8S — CID 135867817
4-[(E)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-propyl-1,2,4-triazole-3-thione (PubChem CID 135867817) has the molecular formula C21H27ClN8S and a molecular weight of 459.02 g/mol. Its IUPAC name is 4-[(E)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-propyl-1,2,4-triazole-3-thione.
| Compound Name | 4-[(E)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-propyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135867817 |
| Molecular Formula | C21H27ClN8S |
| Molecular Weight | 459.02 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[(E)-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-2-[(4-methylpiperazin-1-yl)methyl]-5-propyl-1,2,4-triazole-3-thione |
| SMILES | CCCc1nn(CN2CCN(C)CC2)c(=S)n1/N=C/c1cn[nH]c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN8S/c1-3-4-19-26-29(15-28-11-9-27(2)10-12-28)21(31)30(19)24-14-17-13-23-25-20(17)16-5-7-18(22)8-6-16/h5-8,13-14H,3-4,9-12,15H2,1-2H3,(H,23,25)/b24-14+ |
| InChIKey | HLJGXRPEOWLTCY-ZVHZXABRSA-N |
| XLogP | 3.50 |
| TPSA | 70.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.02 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|