C16H19HgN6O4S- — CID 135873480
[2-amino-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-id-6-yl]sulfanyl-(4-aminophenyl)mercury (PubChem CID 135873480) has the molecular formula C16H19HgN6O4S- and a molecular weight of 592.02 g/mol. Its IUPAC name is [2-amino-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-id-6-yl]sulfanyl-(4-aminophenyl)mercury.
| Compound Name | [2-amino-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-id-6-yl]sulfanyl-(4-aminophenyl)mercury |
|---|---|
| PubChem CID | 135873480 |
| Molecular Formula | C16H19HgN6O4S- |
| Molecular Weight | 592.02 g/mol |
| Exact Mass | 593.09 |
| IUPAC Name | [2-amino-9-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-id-6-yl]sulfanyl-(4-aminophenyl)mercury |
| SMILES | NC1=N[C-](S[Hg]c2ccc(N)cc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@@H]3O)c2N1 |
| InChI | InChI=1S/C10H13N5O4S.C6H6N.Hg/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9;7-6-4-2-1-3-5-6;/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14);2-5H,7H2;/q-2;;+1/t3-,5-,6+,9-;;/m1../s1 |
| InChIKey | VIIOZZACTTWXFY-KKNRVDJNSA-N |
| XLogP | -1.29 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.02 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|