C19H22N4OS2 — CID 135877232
2-methyl-N-[4-[2-(2-thiophen-2-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide (PubChem CID 135877232) has the molecular formula C19H22N4OS2 and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-methyl-N-[4-[2-(2-thiophen-2-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[2-(2-thiophen-2-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 135877232 |
| Molecular Formula | C19H22N4OS2 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-methyl-N-[4-[2-(2-thiophen-2-ylethylimino)-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C2=NN/C(=N/CCc3cccs3)SC2)cc1 |
| InChI | InChI=1S/C19H22N4OS2/c1-13(2)18(24)21-15-7-5-14(6-8-15)17-12-26-19(23-22-17)20-10-9-16-4-3-11-25-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FAUGHJRPYZZWQL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|