C27H18Cl3N3O3 — CID 135877830
(E)-2-[4,6-bis[(E)-1-(4-chlorophenyl)-2-hydroxyethenyl]-1,3,5-triazin-2-yl]-2-(4-chlorophenyl)ethenol (PubChem CID 135877830) has the molecular formula C27H18Cl3N3O3 and a molecular weight of 538.82 g/mol. Its IUPAC name is (E)-2-[4,6-bis[(E)-1-(4-chlorophenyl)-2-hydroxyethenyl]-1,3,5-triazin-2-yl]-2-(4-chlorophenyl)ethenol.
| Compound Name | (E)-2-[4,6-bis[(E)-1-(4-chlorophenyl)-2-hydroxyethenyl]-1,3,5-triazin-2-yl]-2-(4-chlorophenyl)ethenol |
|---|---|
| PubChem CID | 135877830 |
| Molecular Formula | C27H18Cl3N3O3 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | (E)-2-[4,6-bis[(E)-1-(4-chlorophenyl)-2-hydroxyethenyl]-1,3,5-triazin-2-yl]-2-(4-chlorophenyl)ethenol |
| SMILES | O/C=C(\c1ccc(Cl)cc1)c1nc(/C(=C/O)c2ccc(Cl)cc2)nc(/C(=C/O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H18Cl3N3O3/c28-19-7-1-16(2-8-19)22(13-34)25-31-26(23(14-35)17-3-9-20(29)10-4-17)33-27(32-25)24(15-36)18-5-11-21(30)12-6-18/h1-15,34-36H/b22-13+,23-14+,24-15+ |
| InChIKey | AMKOTGIWVOBIIV-ALOUCKEBSA-N |
| XLogP | 7.67 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|