C25H24FN5O6S — CID 135878198
8-amino-6-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethylamino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid (PubChem CID 135878198) has the molecular formula C25H24FN5O6S and a molecular weight of 541.56 g/mol. Its IUPAC name is 8-amino-6-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethylamino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid.
| Compound Name | 8-amino-6-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethylamino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
|---|---|
| PubChem CID | 135878198 |
| Molecular Formula | C25H24FN5O6S |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | 8-amino-6-[2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethylamino]-7-fluoro-10-oxospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
| SMILES | Nc1c(F)c(NCC/N=C2\NS(=O)(=O)c3ccccc32)c2c3c1c(=O)c(C(=O)O)cn3C1(CCCC1)CO2 |
| InChI | InChI=1S/C25H24FN5O6S/c26-17-18(27)16-20-22(37-12-25(7-3-4-8-25)31(20)11-14(21(16)32)24(33)34)19(17)28-9-10-29-23-13-5-1-2-6-15(13)38(35,36)30-23/h1-2,5-6,11,28H,3-4,7-10,12,27H2,(H,29,30)(H,33,34) |
| InChIKey | LBXICODAWOXJSS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 165.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|