C27H27FN4O5S — CID 58134734
11-acetyl-8-amino-6-[3-(1,1-dioxo-1,2-benzothiazol-3-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one (PubChem CID 58134734) has the molecular formula C27H27FN4O5S and a molecular weight of 538.60 g/mol. Its IUPAC name is 11-acetyl-8-amino-6-[3-(1,1-dioxo-1,2-benzothiazol-3-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one.
| Compound Name | 11-acetyl-8-amino-6-[3-(1,1-dioxo-1,2-benzothiazol-3-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
|---|---|
| PubChem CID | 58134734 |
| Molecular Formula | C27H27FN4O5S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | 11-acetyl-8-amino-6-[3-(1,1-dioxo-1,2-benzothiazol-3-yl)propylamino]-7-fluorospiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
| SMILES | CC(=O)c1cn2c3c(c(NCCCC4=NS(=O)(=O)c5ccccc54)c(F)c(N)c3c1=O)OCC21CCCC1 |
| InChI | InChI=1S/C27H27FN4O5S/c1-15(33)17-13-32-24-20(25(17)34)22(29)21(28)23(26(24)37-14-27(32)10-4-5-11-27)30-12-6-8-18-16-7-2-3-9-19(16)38(35,36)31-18/h2-3,7,9,13,30H,4-6,8,10-12,14,29H2,1H3 |
| InChIKey | VTIOKHYUFFQFDJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 132.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|