C23H29FN4O6S — CID 25252892
8-amino-7-fluoro-10-oxo-6-(2-piperidin-1-ylsulfonylethylamino)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid (PubChem CID 25252892) has the molecular formula C23H29FN4O6S and a molecular weight of 508.57 g/mol. Its IUPAC name is 8-amino-7-fluoro-10-oxo-6-(2-piperidin-1-ylsulfonylethylamino)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid.
| Compound Name | 8-amino-7-fluoro-10-oxo-6-(2-piperidin-1-ylsulfonylethylamino)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
|---|---|
| PubChem CID | 25252892 |
| Molecular Formula | C23H29FN4O6S |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 8-amino-7-fluoro-10-oxo-6-(2-piperidin-1-ylsulfonylethylamino)spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-11-carboxylic acid |
| SMILES | Nc1c(F)c(NCCS(=O)(=O)N2CCCCC2)c2c3c1c(=O)c(C(=O)O)cn3C1(CCCC1)CO2 |
| InChI | InChI=1S/C23H29FN4O6S/c24-16-17(25)15-19-21(18(16)26-8-11-35(32,33)27-9-4-1-5-10-27)34-13-23(6-2-3-7-23)28(19)12-14(20(15)29)22(30)31/h12,26H,1-11,13,25H2,(H,30,31) |
| InChIKey | UEWNPOQXJLGCLD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|