C19H14INO — CID 135879577
1-(3,4-dihydroisoquinolin-1-yl)-3-iodonaphthalen-2-ol (PubChem CID 135879577) has the molecular formula C19H14INO and a molecular weight of 399.23 g/mol. Its IUPAC name is 1-(3,4-dihydroisoquinolin-1-yl)-3-iodonaphthalen-2-ol.
| Compound Name | 1-(3,4-dihydroisoquinolin-1-yl)-3-iodonaphthalen-2-ol |
|---|---|
| PubChem CID | 135879577 |
| Molecular Formula | C19H14INO |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | 1-(3,4-dihydroisoquinolin-1-yl)-3-iodonaphthalen-2-ol |
| SMILES | Oc1c(I)cc2ccccc2c1C1=NCCc2ccccc21 |
| InChI | InChI=1S/C19H14INO/c20-16-11-13-6-2-3-7-14(13)17(19(16)22)18-15-8-4-1-5-12(15)9-10-21-18/h1-8,11,22H,9-10H2 |
| InChIKey | SFYJMMDSQHTANZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|