C17H35N5 — CID 135879961
6-butylimino-2,2-dimethyl-3-octyl-1H-1,3,5-triazin-4-amine (PubChem CID 135879961) has the molecular formula C17H35N5 and a molecular weight of 309.50 g/mol. Its IUPAC name is 6-butylimino-2,2-dimethyl-3-octyl-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-butylimino-2,2-dimethyl-3-octyl-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 135879961 |
| Molecular Formula | C17H35N5 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.29 |
| IUPAC Name | 6-butylimino-2,2-dimethyl-3-octyl-1H-1,3,5-triazin-4-amine |
| SMILES | CCCCCCCCN1C(N)=N/C(=N\CCCC)NC1(C)C |
| InChI | InChI=1S/C17H35N5/c1-5-7-9-10-11-12-14-22-15(18)20-16(19-13-8-6-2)21-17(22,3)4/h5-14H2,1-4H3,(H3,18,19,20,21) |
| InChIKey | JYSFUFGXGDGBMX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|