C23H39N5 — CID 135879934
6-decylimino-2,2-dimethyl-3-[(4-methylphenyl)methyl]-1H-1,3,5-triazin-4-amine (PubChem CID 135879934) has the molecular formula C23H39N5 and a molecular weight of 385.60 g/mol. Its IUPAC name is 6-decylimino-2,2-dimethyl-3-[(4-methylphenyl)methyl]-1H-1,3,5-triazin-4-amine.
| Compound Name | 6-decylimino-2,2-dimethyl-3-[(4-methylphenyl)methyl]-1H-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 135879934 |
| Molecular Formula | C23H39N5 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | 6-decylimino-2,2-dimethyl-3-[(4-methylphenyl)methyl]-1H-1,3,5-triazin-4-amine |
| SMILES | CCCCCCCCCC/N=C1\N=C(N)N(Cc2ccc(C)cc2)C(C)(C)N1 |
| InChI | InChI=1S/C23H39N5/c1-5-6-7-8-9-10-11-12-17-25-22-26-21(24)28(23(3,4)27-22)18-20-15-13-19(2)14-16-20/h13-16H,5-12,17-18H2,1-4H3,(H3,24,25,26,27) |
| InChIKey | YAVJEQHCNTZBAY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|