C17H20ClN3O2S — CID 135882486
5-[[(1S)-1-(3-chlorophenyl)ethyl]iminomethyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135882486) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 5-[[(1S)-1-(3-chlorophenyl)ethyl]iminomethyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[[(1S)-1-(3-chlorophenyl)ethyl]iminomethyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135882486 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-[[(1S)-1-(3-chlorophenyl)ethyl]iminomethyl]-1,3-diethyl-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCn1c(O)c(/C=N/[C@@H](C)c2cccc(Cl)c2)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C17H20ClN3O2S/c1-4-20-15(22)14(16(23)21(5-2)17(20)24)10-19-11(3)12-7-6-8-13(18)9-12/h6-11,22H,4-5H2,1-3H3/b19-10+/t11-/m0/s1 |
| InChIKey | COKNZHSJNUBSEO-VSMYLPJWSA-N |
| XLogP | 3.96 |
| TPSA | 59.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|