C13H14FN3O3 — CID 135886556
1-(4-fluorophenyl)-3-[(5R)-4-oxo-5-propan-2-yl-1,3-oxazolidin-2-ylidene]urea (PubChem CID 135886556) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(5R)-4-oxo-5-propan-2-yl-1,3-oxazolidin-2-ylidene]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(5R)-4-oxo-5-propan-2-yl-1,3-oxazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 135886556 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(5R)-4-oxo-5-propan-2-yl-1,3-oxazolidin-2-ylidene]urea |
| SMILES | CC(C)[C@H]1OC(=NC(=O)Nc2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C13H14FN3O3/c1-7(2)10-11(18)16-13(20-10)17-12(19)15-9-5-3-8(14)4-6-9/h3-7,10H,1-2H3,(H2,15,16,17,18,19)/t10-/m1/s1 |
| InChIKey | QUAFTLJQAWWHKX-SNVBAGLBSA-N |
| XLogP | 1.88 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|