C27H30N4O7S2 — CID 135887195
N-[3-[(2S,7R)-6-hydroxy-3-[(3-methoxyphenyl)methyl]-4-oxo-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide (PubChem CID 135887195) has the molecular formula C27H30N4O7S2 and a molecular weight of 586.69 g/mol. Its IUPAC name is N-[3-[(2S,7R)-6-hydroxy-3-[(3-methoxyphenyl)methyl]-4-oxo-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide.
| Compound Name | N-[3-[(2S,7R)-6-hydroxy-3-[(3-methoxyphenyl)methyl]-4-oxo-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 135887195 |
| Molecular Formula | C27H30N4O7S2 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | N-[3-[(2S,7R)-6-hydroxy-3-[(3-methoxyphenyl)methyl]-4-oxo-3-azatricyclo[6.2.2.02,7]dodec-5-en-5-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]methanesulfonamide |
| SMILES | COc1cccc(CN2C(=O)C(C3=NS(=O)(=O)c4cc(NS(C)(=O)=O)ccc4N3)=C(O)[C@@H]3C4CCC(CC4)[C@@H]32)c1 |
| InChI | InChI=1S/C27H30N4O7S2/c1-38-19-5-3-4-15(12-19)14-31-24-17-8-6-16(7-9-17)22(24)25(32)23(27(31)33)26-28-20-11-10-18(29-39(2,34)35)13-21(20)40(36,37)30-26/h3-5,10-13,16-17,22,24,29,32H,6-9,14H2,1-2H3,(H,28,30)/t16?,17?,22-,24+/m1/s1 |
| InChIKey | RIKVJIIULMMMKZ-UGSPWLTQSA-N |
| XLogP | 3.24 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |