C23H22ClN3O3S — CID 135888414
4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-imino-2H-pyrrol-3-ol (PubChem CID 135888414) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135888414 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-1-[2-(3,4-dimethoxyphenyl)ethyl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccccc3Cl)cs2)=C(O)CN1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-29-19-8-7-14(11-20(19)30-2)9-10-27-12-18(28)21(22(27)25)23-26-17(13-31-23)15-5-3-4-6-16(15)24/h3-8,11,13,25,28H,9-10,12H2,1-2H3/b25-22- |
| InChIKey | SVDKTNSYMVPUSN-LVWGJNHUSA-N |
| XLogP | 5.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|