C17H13N5O3S — CID 135891325
[(E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-1-phenylethenyl]iminothiourea (PubChem CID 135891325) has the molecular formula C17H13N5O3S and a molecular weight of 367.39 g/mol. Its IUPAC name is [(E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-1-phenylethenyl]iminothiourea.
| Compound Name | [(E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-1-phenylethenyl]iminothiourea |
|---|---|
| PubChem CID | 135891325 |
| Molecular Formula | C17H13N5O3S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | [(E)-2-(2-hydroxy-5-nitro-1H-indol-3-yl)-1-phenylethenyl]iminothiourea |
| SMILES | NC(=S)/N=N/C(=C/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12)c1ccccc1 |
| InChI | InChI=1S/C17H13N5O3S/c18-17(26)21-20-15(10-4-2-1-3-5-10)9-13-12-8-11(22(24)25)6-7-14(12)19-16(13)23/h1-9,19,23H,(H2,18,26)/b15-9+,21-20+ |
| InChIKey | MTRVMUBIDYPAKK-UVKJFHOBSA-N |
| XLogP | 3.98 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|