C15H21ClN4O3 — CID 135964747
3-[2-(diethylamino)ethyliminomethyl]-5-nitro-1H-indol-2-ol;hydrochloride (PubChem CID 135964747) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyliminomethyl]-5-nitro-1H-indol-2-ol;hydrochloride.
| Compound Name | 3-[2-(diethylamino)ethyliminomethyl]-5-nitro-1H-indol-2-ol;hydrochloride |
|---|---|
| PubChem CID | 135964747 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-[2-(diethylamino)ethyliminomethyl]-5-nitro-1H-indol-2-ol;hydrochloride |
| SMILES | CCN(CC)CC/N=C/c1c(O)[nH]c2ccc([N+](=O)[O-])cc12.Cl |
| InChI | InChI=1S/C15H20N4O3.ClH/c1-3-18(4-2)8-7-16-10-13-12-9-11(19(21)22)5-6-14(12)17-15(13)20;/h5-6,9-10,17,20H,3-4,7-8H2,1-2H3;1H/b16-10+; |
| InChIKey | FRTFXMRERNQQHL-QFHYWFJHSA-N |
| XLogP | 2.96 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|