C14H9ClN4O2S2 — CID 135893696
5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]iminomethyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 135893696) has the molecular formula C14H9ClN4O2S2 and a molecular weight of 364.84 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]iminomethyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]iminomethyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 135893696 |
| Molecular Formula | C14H9ClN4O2S2 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]iminomethyl]-6-hydroxy-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c(O)c1C=Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C14H9ClN4O2S2/c15-8-3-1-7(2-4-8)10-6-23-14(17-10)16-5-9-11(20)18-13(22)19-12(9)21/h1-6H,(H3,18,19,20,21,22) |
| InChIKey | KEUFRJZSWHYLMP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|