C22H19N5O3 — CID 135896273
(8R)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-8-(3-methylphenyl)-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione (PubChem CID 135896273) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is (8R)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-8-(3-methylphenyl)-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione.
| Compound Name | (8R)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-8-(3-methylphenyl)-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 135896273 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (8R)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)-8-(3-methylphenyl)-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
| SMILES | Cc1cccc([C@H]2CC(=O)c3cnc4[nH]n(-c5nc(C)cc(=O)[nH]5)c(=O)c4c3C2)c1 |
| InChI | InChI=1S/C22H19N5O3/c1-11-4-3-5-13(6-11)14-8-15-16(17(28)9-14)10-23-20-19(15)21(30)27(26-20)22-24-12(2)7-18(29)25-22/h3-7,10,14H,8-9H2,1-2H3,(H,23,26)(H,24,25,29)/t14-/m1/s1 |
| InChIKey | MMURFOJBKABAMT-CQSZACIVSA-N |
| XLogP | 2.33 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|