C23H19N3O2 — CID 41178199
(8R)-8-(2-methylphenyl)-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione (PubChem CID 41178199) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (8R)-8-(2-methylphenyl)-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione.
| Compound Name | (8R)-8-(2-methylphenyl)-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 41178199 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (8R)-8-(2-methylphenyl)-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
| SMILES | Cc1ccccc1[C@H]1CC(=O)c2cnc3[nH]n(-c4ccccc4)c(=O)c3c2C1 |
| InChI | InChI=1S/C23H19N3O2/c1-14-7-5-6-10-17(14)15-11-18-19(20(27)12-15)13-24-22-21(18)23(28)26(25-22)16-8-3-2-4-9-16/h2-10,13,15H,11-12H2,1H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | XWXSJFVEYFUISB-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|