C17H15N3O2 — CID 41178197
(8S)-8-methyl-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione (PubChem CID 41178197) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is (8S)-8-methyl-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione.
| Compound Name | (8S)-8-methyl-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 41178197 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (8S)-8-methyl-2-phenyl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
| SMILES | C[C@@H]1CC(=O)c2cnc3[nH]n(-c4ccccc4)c(=O)c3c2C1 |
| InChI | InChI=1S/C17H15N3O2/c1-10-7-12-13(14(21)8-10)9-18-16-15(12)17(22)20(19-16)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | XBYKPTDFNYHJET-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|